C7H12BNO4S — CID 89369227
[(2Z,4E)-5-sulfamoylhepta-2,4,6-trien-2-yl]boronic acid (PubChem CID 89369227) has the molecular formula C7H12BNO4S and a molecular weight of 217.06 g/mol. Its IUPAC name is [(2Z,4E)-5-sulfamoylhepta-2,4,6-trien-2-yl]boronic acid.
| Compound Name | [(2Z,4E)-5-sulfamoylhepta-2,4,6-trien-2-yl]boronic acid |
|---|---|
| PubChem CID | 89369227 |
| Molecular Formula | C7H12BNO4S |
| Molecular Weight | 217.06 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | [(2Z,4E)-5-sulfamoylhepta-2,4,6-trien-2-yl]boronic acid |
| SMILES | C=C/C(=C\C=C(/C)B(O)O)S(N)(=O)=O |
| InChI | InChI=1S/C7H12BNO4S/c1-3-7(14(9,12)13)5-4-6(2)8(10)11/h3-5,10-11H,1H2,2H3,(H2,9,12,13)/b6-4+,7-5+ |
| InChIKey | BGLHHABQDCSGTF-YDFGWWAZSA-N |
| XLogP | -0.70 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.06 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|