C10H15BO4 — CID 177060114
[(3Z,5E)-5-ethoxycarbonylhepta-1,3,5-trien-4-yl]boronic acid (PubChem CID 177060114) has the molecular formula C10H15BO4 and a molecular weight of 210.04 g/mol. Its IUPAC name is [(3Z,5E)-5-ethoxycarbonylhepta-1,3,5-trien-4-yl]boronic acid.
| Compound Name | [(3Z,5E)-5-ethoxycarbonylhepta-1,3,5-trien-4-yl]boronic acid |
|---|---|
| PubChem CID | 177060114 |
| Molecular Formula | C10H15BO4 |
| Molecular Weight | 210.04 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | [(3Z,5E)-5-ethoxycarbonylhepta-1,3,5-trien-4-yl]boronic acid |
| SMILES | C=C/C=C(B(O)O)\C(=C/C)C(=O)OCC |
| InChI | InChI=1S/C10H15BO4/c1-4-7-9(11(13)14)8(5-2)10(12)15-6-3/h4-5,7,13-14H,1,6H2,2-3H3/b8-5+,9-7+ |
| InChIKey | YFCPRATTYUGANL-OCIXRKKMSA-N |
| XLogP | 0.62 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.04 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|