C18H24O3 — CID 144784806
ethane;(4E)-4-[(4-hydroxy-2-methylphenoxy)methyl]-3-methylidenehepta-4,6-dien-2-one (PubChem CID 144784806) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is ethane;(4E)-4-[(4-hydroxy-2-methylphenoxy)methyl]-3-methylidenehepta-4,6-dien-2-one.
| Compound Name | ethane;(4E)-4-[(4-hydroxy-2-methylphenoxy)methyl]-3-methylidenehepta-4,6-dien-2-one |
|---|---|
| PubChem CID | 144784806 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | ethane;(4E)-4-[(4-hydroxy-2-methylphenoxy)methyl]-3-methylidenehepta-4,6-dien-2-one |
| SMILES | C=C/C=C(/COc1ccc(O)cc1C)C(=C)C(C)=O.CC |
| InChI | InChI=1S/C16H18O3.C2H6/c1-5-6-14(12(3)13(4)17)10-19-16-8-7-15(18)9-11(16)2;1-2/h5-9,18H,1,3,10H2,2,4H3;1-2H3/b14-6-; |
| InChIKey | CSFCABLHSUENEV-WQMRFYCQSA-N |
| XLogP | 4.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|