C9H16S — CID 131975320
2,5-dimethyl-4-methylidenehex-2-ene-3-thiol (PubChem CID 131975320) has the molecular formula C9H16S and a molecular weight of 156.29 g/mol. Its IUPAC name is 2,5-dimethyl-4-methylidenehex-2-ene-3-thiol.
| Compound Name | 2,5-dimethyl-4-methylidenehex-2-ene-3-thiol |
|---|---|
| PubChem CID | 131975320 |
| Molecular Formula | C9H16S |
| Molecular Weight | 156.29 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 2,5-dimethyl-4-methylidenehex-2-ene-3-thiol |
| SMILES | C=C(C(S)=C(C)C)C(C)C |
| InChI | InChI=1S/C9H16S/c1-6(2)8(5)9(10)7(3)4/h6,10H,5H2,1-4H3 |
| InChIKey | LYVNETAFZXOMAR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|