C12H26 — CID 178040270
(E)-3,4-dimethylpent-2-ene;ethene;propane (PubChem CID 178040270) has the molecular formula C12H26 and a molecular weight of 170.34 g/mol. Its IUPAC name is (E)-3,4-dimethylpent-2-ene;ethene;propane.
| Compound Name | (E)-3,4-dimethylpent-2-ene;ethene;propane |
|---|---|
| PubChem CID | 178040270 |
| Molecular Formula | C12H26 |
| Molecular Weight | 170.34 g/mol |
| Exact Mass | 170.20 |
| IUPAC Name | (E)-3,4-dimethylpent-2-ene;ethene;propane |
| SMILES | C/C=C(\C)C(C)C.C=C.CCC |
| InChI | InChI=1S/C7H14.C3H8.C2H4/c1-5-7(4)6(2)3;1-3-2;1-2/h5-6H,1-4H3;3H2,1-2H3;1-2H2/b7-5+;; |
| InChIKey | UDKGYMKMEPBUPF-WVKUUHRJSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.34 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|