C7H13Cl — CID 14510616
(E)-1-chloro-3,4-dimethylpent-2-ene (PubChem CID 14510616) has the molecular formula C7H13Cl and a molecular weight of 132.63 g/mol. Its IUPAC name is (E)-1-chloro-3,4-dimethylpent-2-ene.
| Compound Name | (E)-1-chloro-3,4-dimethylpent-2-ene |
|---|---|
| PubChem CID | 14510616 |
| Molecular Formula | C7H13Cl |
| Molecular Weight | 132.63 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | (E)-1-chloro-3,4-dimethylpent-2-ene |
| SMILES | C/C(=C\CCl)C(C)C |
| InChI | InChI=1S/C7H13Cl/c1-6(2)7(3)4-5-8/h4,6H,5H2,1-3H3/b7-4+ |
| InChIKey | NIJYMTBRRMWVOM-QPJJXVBHSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.63 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|