C10H18O2 — CID 162716838
6,7-dimethyloct-5-enoic acid (PubChem CID 162716838) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 6,7-dimethyloct-5-enoic acid.
| Compound Name | 6,7-dimethyloct-5-enoic acid |
|---|---|
| PubChem CID | 162716838 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 6,7-dimethyloct-5-enoic acid |
| SMILES | CC(=CCCCC(=O)O)C(C)C |
| InChI | InChI=1S/C10H18O2/c1-8(2)9(3)6-4-5-7-10(11)12/h6,8H,4-5,7H2,1-3H3,(H,11,12) |
| InChIKey | IAGICLNYUDOBIQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|