C11H20 — CID 91463486
(5E)-3,6,7-trimethylocta-2,5-diene (PubChem CID 91463486) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is (5E)-3,6,7-trimethylocta-2,5-diene.
| Compound Name | (5E)-3,6,7-trimethylocta-2,5-diene |
|---|---|
| PubChem CID | 91463486 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | (5E)-3,6,7-trimethylocta-2,5-diene |
| SMILES | CC=C(C)C/C=C(\C)C(C)C |
| InChI | InChI=1S/C11H20/c1-6-10(4)7-8-11(5)9(2)3/h6,8-9H,7H2,1-5H3/b10-6?,11-8+ |
| InChIKey | DDHYEZZUKVFERY-VJJUCBOQSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|