C11H19NO2 — CID 123817540
(2E)-N-methoxy-N,2,5-trimethylhepta-2,5-dienamide (PubChem CID 123817540) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (2E)-N-methoxy-N,2,5-trimethylhepta-2,5-dienamide.
| Compound Name | (2E)-N-methoxy-N,2,5-trimethylhepta-2,5-dienamide |
|---|---|
| PubChem CID | 123817540 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (2E)-N-methoxy-N,2,5-trimethylhepta-2,5-dienamide |
| SMILES | CC=C(C)C/C=C(\C)C(=O)N(C)OC |
| InChI | InChI=1S/C11H19NO2/c1-6-9(2)7-8-10(3)11(13)12(4)14-5/h6,8H,7H2,1-5H3/b9-6?,10-8+ |
| InChIKey | VYSUWYDYEXWKRQ-OWBFWQEZSA-N |
| XLogP | 2.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|