C12H22N2O4 — CID 87659747
[(E,3S)-6-[methoxy(methyl)amino]-2,5-dimethyl-6-oxohex-4-en-3-yl]-methylcarbamic acid (PubChem CID 87659747) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is [(E,3S)-6-[methoxy(methyl)amino]-2,5-dimethyl-6-oxohex-4-en-3-yl]-methylcarbamic acid.
| Compound Name | [(E,3S)-6-[methoxy(methyl)amino]-2,5-dimethyl-6-oxohex-4-en-3-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 87659747 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | [(E,3S)-6-[methoxy(methyl)amino]-2,5-dimethyl-6-oxohex-4-en-3-yl]-methylcarbamic acid |
| SMILES | CON(C)C(=O)/C(C)=C/[C@H](C(C)C)N(C)C(=O)O |
| InChI | InChI=1S/C12H22N2O4/c1-8(2)10(13(4)12(16)17)7-9(3)11(15)14(5)18-6/h7-8,10H,1-6H3,(H,16,17)/b9-7+/t10-/m1/s1 |
| InChIKey | CGVXBLAHMFNOBB-TTZKWOQHSA-N |
| XLogP | 1.59 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|