C20H38N2O5 — CID 154932369
(E,4S)-4-[[(2S)-2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid (PubChem CID 154932369) has the molecular formula C20H38N2O5 and a molecular weight of 386.53 g/mol. Its IUPAC name is (E,4S)-4-[[(2S)-2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid.
| Compound Name | (E,4S)-4-[[(2S)-2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
|---|---|
| PubChem CID | 154932369 |
| Molecular Formula | C20H38N2O5 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | (E,4S)-4-[[(2S)-2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
| SMILES | C/C(=C\[C@H](C(C)C)N(C)C(=O)[C@@H](NC(O)OC(C)(C)C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C20H38N2O5/c1-12(2)14(11-13(3)17(24)25)22(10)16(23)15(19(4,5)6)21-18(26)27-20(7,8)9/h11-12,14-15,18,21,26H,1-10H3,(H,24,25)/b13-11+/t14-,15-,18?/m1/s1 |
| InChIKey | GVRUICNBBLCOEN-AEQOTBQSSA-N |
| XLogP | 2.60 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|