C11H17NO4 — CID 132851303
ethyl (2E,4Z)-6-[methoxy(methyl)amino]-5-methyl-6-oxohexa-2,4-dienoate (PubChem CID 132851303) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is ethyl (2E,4Z)-6-[methoxy(methyl)amino]-5-methyl-6-oxohexa-2,4-dienoate.
| Compound Name | ethyl (2E,4Z)-6-[methoxy(methyl)amino]-5-methyl-6-oxohexa-2,4-dienoate |
|---|---|
| PubChem CID | 132851303 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | ethyl (2E,4Z)-6-[methoxy(methyl)amino]-5-methyl-6-oxohexa-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C=C(/C)C(=O)N(C)OC |
| InChI | InChI=1S/C11H17NO4/c1-5-16-10(13)8-6-7-9(2)11(14)12(3)15-4/h6-8H,5H2,1-4H3/b8-6+,9-7- |
| InChIKey | NVLUEUXTLYXYRJ-FFELTBSMSA-N |
| XLogP | 1.07 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|