C15H28 — CID 123965899
3,4-dimethyl-7-propan-2-yldeca-2,7-diene (PubChem CID 123965899) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is 3,4-dimethyl-7-propan-2-yldeca-2,7-diene.
| Compound Name | 3,4-dimethyl-7-propan-2-yldeca-2,7-diene |
|---|---|
| PubChem CID | 123965899 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | 3,4-dimethyl-7-propan-2-yldeca-2,7-diene |
| SMILES | CC=C(C)C(C)CCC(=CCC)C(C)C |
| InChI | InChI=1S/C15H28/c1-7-9-15(12(3)4)11-10-14(6)13(5)8-2/h8-9,12,14H,7,10-11H2,1-6H3 |
| InChIKey | IQDUQLMCBUVOMP-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|