About 2,4-dimethylhexan-1-imine
2,4-dimethylhexan-1-imine (PubChem CID 88882138) has the molecular formula C8H17N
and a molecular weight of 127.23 g/mol. Its IUPAC name is 2,4-dimethylhexan-1-imine.
Molecular Properties
| Compound Name | 2,4-dimethylhexan-1-imine |
| PubChem CID | 88882138 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | 2,4-dimethylhexan-1-imine |
| SMILES | [H]/N=C/C(C)CC(C)CC |
| InChI | InChI=1S/C8H17N/c1-4-7(2)5-8(3)6-9/h6-9H,4-5H2,1-3H3/b9-6+ |
| InChIKey | NNBGCEHARFIQBZ-RMKNXTFCSA-N |
| XLogP | 2.71 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethylhexan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylhexan-1-imine?
The IUPAC name of 2,4-dimethylhexan-1-imine (CID 88882138) is 2,4-dimethylhexan-1-imine.
What is the SMILES notation for 2,4-dimethylhexan-1-imine?
The canonical SMILES for 2,4-dimethylhexan-1-imine is [H]/N=C/C(C)CC(C)CC.
What is the InChIKey of 2,4-dimethylhexan-1-imine?
The InChIKey is NNBGCEHARFIQBZ-RMKNXTFCSA-N. The full InChI is InChI=1S/C8H17N/c1-4-7(2)5-8(3)6-9/h6-9H,4-5H2,1-3H3/b9-6+.
What are the key properties of 2,4-dimethylhexan-1-imine?
2,4-dimethylhexan-1-imine has a molecular weight of 127.23 g/mol, XLogP of 2.71, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylhexan-1-imine is sourced from PubChem (CID 88882138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).