About N'-(4-methylhexyl)ethane-1,2-diimine
N'-(4-methylhexyl)ethane-1,2-diimine (PubChem CID 174359205) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is N'-(4-methylhexyl)ethane-1,2-diimine.
Molecular Properties
| Compound Name | N'-(4-methylhexyl)ethane-1,2-diimine |
| PubChem CID | 174359205 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | N'-(4-methylhexyl)ethane-1,2-diimine |
| SMILES | [H]/N=C/C=N/CCCC(C)CC |
| InChI | InChI=1S/C9H18N2/c1-3-9(2)5-4-7-11-8-6-10/h6,8-10H,3-5,7H2,1-2H3/b10-6+,11-8+ |
| InChIKey | RJTHYGMMYABIRZ-NSJFVGFPSA-N |
| XLogP | 2.53 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-methylhexyl)ethane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-methylhexyl)ethane-1,2-diimine?
The IUPAC name of N'-(4-methylhexyl)ethane-1,2-diimine (CID 174359205) is N'-(4-methylhexyl)ethane-1,2-diimine.
What is the SMILES notation for N'-(4-methylhexyl)ethane-1,2-diimine?
The canonical SMILES for N'-(4-methylhexyl)ethane-1,2-diimine is [H]/N=C/C=N/CCCC(C)CC.
What is the InChIKey of N'-(4-methylhexyl)ethane-1,2-diimine?
The InChIKey is RJTHYGMMYABIRZ-NSJFVGFPSA-N. The full InChI is InChI=1S/C9H18N2/c1-3-9(2)5-4-7-11-8-6-10/h6,8-10H,3-5,7H2,1-2H3/b10-6+,11-8+.
What are the key properties of N'-(4-methylhexyl)ethane-1,2-diimine?
N'-(4-methylhexyl)ethane-1,2-diimine has a molecular weight of 154.26 g/mol, XLogP of 2.53, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-methylhexyl)ethane-1,2-diimine is sourced from PubChem (CID 174359205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).