C9H14V — CID 161094139
4-propan-2-ylhexa-2,4-dienylidenevanadium (PubChem CID 161094139) has the molecular formula C9H14V and a molecular weight of 173.16 g/mol. Its IUPAC name is 4-propan-2-ylhexa-2,4-dienylidenevanadium.
| Compound Name | 4-propan-2-ylhexa-2,4-dienylidenevanadium |
|---|---|
| PubChem CID | 161094139 |
| Molecular Formula | C9H14V |
| Molecular Weight | 173.16 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 4-propan-2-ylhexa-2,4-dienylidenevanadium |
| SMILES | CC=C(C=CC=[V])C(C)C |
| InChI | InChI=1S/C9H14.V/c1-5-7-9(6-2)8(3)4;/h1,5-8H,2-4H3; |
| InChIKey | PJFCXKQRQPCGTQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.16 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|