C13H25V- — CID 161094138
ethane;4-propan-2-ylhexa-2,4-dienylidenevanadium (PubChem CID 161094138) has the molecular formula C13H25V- and a molecular weight of 232.29 g/mol. Its IUPAC name is ethane;4-propan-2-ylhexa-2,4-dienylidenevanadium.
| Compound Name | ethane;4-propan-2-ylhexa-2,4-dienylidenevanadium |
|---|---|
| PubChem CID | 161094138 |
| Molecular Formula | C13H25V- |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | ethane;4-propan-2-ylhexa-2,4-dienylidenevanadium |
| SMILES | C/[C-]=C(/C=CC=[V])C(C)C.CC.CC |
| InChI | InChI=1S/C9H13.2C2H6.V/c1-5-7-9(6-2)8(3)4;2*1-2;/h1,5,7-8H,2-4H3;2*1-2H3;/q-1;;; |
| InChIKey | YHVFZYOPOUCRJJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|