C12H21La — CID 146903770
lanthanum(3+);propane;4-propan-2-ylhexa-1,4-diene (PubChem CID 146903770) has the molecular formula C12H21La and a molecular weight of 304.21 g/mol. Its IUPAC name is lanthanum(3+);propane;4-propan-2-ylhexa-1,4-diene.
| Compound Name | lanthanum(3+);propane;4-propan-2-ylhexa-1,4-diene |
|---|---|
| PubChem CID | 146903770 |
| Molecular Formula | C12H21La |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | lanthanum(3+);propane;4-propan-2-ylhexa-1,4-diene |
| SMILES | C[CH-]C.[H]/[C-]=C/C/C(=[C-]/C)C(C)C.[La+3] |
| InChI | InChI=1S/C9H14.C3H7.La/c1-5-7-9(6-2)8(3)4;1-3-2;/h1,5,8H,7H2,2-4H3;3H,1-2H3;/q-2;-1;+3 |
| InChIKey | QSDQURQMJXGZID-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|