C10H16Y-2 — CID 58430468
5-methanidylidene-2,6-dimethylhept-3-ene;yttrium (PubChem CID 58430468) has the molecular formula C10H16Y-2 and a molecular weight of 225.14 g/mol. Its IUPAC name is 5-methanidylidene-2,6-dimethylhept-3-ene;yttrium.
| Compound Name | 5-methanidylidene-2,6-dimethylhept-3-ene;yttrium |
|---|---|
| PubChem CID | 58430468 |
| Molecular Formula | C10H16Y-2 |
| Molecular Weight | 225.14 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 5-methanidylidene-2,6-dimethylhept-3-ene;yttrium |
| SMILES | [H]/[C-]=C(/C=[C-]/C(C)C)C(C)C.[Y] |
| InChI | InChI=1S/C10H16.Y/c1-8(2)6-7-10(5)9(3)4;/h5,7-9H,1-4H3;/q-2; |
| InChIKey | CRDURJVFTUPADR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.14 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|