About (3Z)-2-methylpenta-1,3-diene;yttrium
(3Z)-2-methylpenta-1,3-diene;yttrium (PubChem CID 58172805) has the molecular formula C6H8Y-2
and a molecular weight of 169.04 g/mol. Its IUPAC name is (3Z)-2-methylpenta-1,3-diene;yttrium.
Molecular Properties
| Compound Name | (3Z)-2-methylpenta-1,3-diene;yttrium |
| PubChem CID | 58172805 |
| Molecular Formula | C6H8Y-2 |
| Molecular Weight | 169.04 g/mol |
| Exact Mass | 168.97 |
| IUPAC Name | (3Z)-2-methylpenta-1,3-diene;yttrium |
| SMILES | [H]/[C-]=C(C)/C=C\[CH2-].[Y] |
| InChI | InChI=1S/C6H8.Y/c1-4-5-6(2)3;/h2,4-5H,1H2,3H3;/q-2;/b5-4-; |
| InChIKey | ZZCICLVXTTVEJL-MKWAYWHRSA-N |
| XLogP | 1.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.04 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-2-methylpenta-1,3-diene;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-2-methylpenta-1,3-diene;yttrium?
The IUPAC name of (3Z)-2-methylpenta-1,3-diene;yttrium (CID 58172805) is (3Z)-2-methylpenta-1,3-diene;yttrium.
What is the SMILES notation for (3Z)-2-methylpenta-1,3-diene;yttrium?
The canonical SMILES for (3Z)-2-methylpenta-1,3-diene;yttrium is [H]/[C-]=C(C)/C=C\[CH2-].[Y].
What is the InChIKey of (3Z)-2-methylpenta-1,3-diene;yttrium?
The InChIKey is ZZCICLVXTTVEJL-MKWAYWHRSA-N. The full InChI is InChI=1S/C6H8.Y/c1-4-5-6(2)3;/h2,4-5H,1H2,3H3;/q-2;/b5-4-;.
What are the key properties of (3Z)-2-methylpenta-1,3-diene;yttrium?
(3Z)-2-methylpenta-1,3-diene;yttrium has a molecular weight of 169.04 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-2-methylpenta-1,3-diene;yttrium is sourced from PubChem (CID 58172805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).