C6H8Y-2 — CID 58172805
(3Z)-2-methylpenta-1,3-diene;yttrium (PubChem CID 58172805) has the molecular formula C6H8Y-2 and a molecular weight of 169.04 g/mol. Its IUPAC name is (3Z)-2-methylpenta-1,3-diene;yttrium.
| Compound Name | (3Z)-2-methylpenta-1,3-diene;yttrium |
|---|---|
| PubChem CID | 58172805 |
| Molecular Formula | C6H8Y-2 |
| Molecular Weight | 169.04 g/mol |
| Exact Mass | 168.97 |
| IUPAC Name | (3Z)-2-methylpenta-1,3-diene;yttrium |
| SMILES | [H]/[C-]=C(C)/C=C\[CH2-].[Y] |
| InChI | InChI=1S/C6H8.Y/c1-4-5-6(2)3;/h2,4-5H,1H2,3H3;/q-2;/b5-4-; |
| InChIKey | ZZCICLVXTTVEJL-MKWAYWHRSA-N |
| XLogP | 1.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.04 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|