About carbanide;cobalt(3+);2-methanidylprop-1-ene
carbanide;cobalt(3+);2-methanidylprop-1-ene (PubChem CID 59163874) has the molecular formula C5H9Co
and a molecular weight of 128.06 g/mol. Its IUPAC name is carbanide;cobalt(3+);2-methanidylprop-1-ene.
Molecular Properties
| Compound Name | carbanide;cobalt(3+);2-methanidylprop-1-ene |
| PubChem CID | 59163874 |
| Molecular Formula | C5H9Co |
| Molecular Weight | 128.06 g/mol |
| Exact Mass | 128.00 |
| IUPAC Name | carbanide;cobalt(3+);2-methanidylprop-1-ene |
| SMILES | [CH3-].[Co+3].[H]/[C-]=C(/[CH2-])C |
| InChI | InChI=1S/C4H6.CH3.Co/c1-4(2)3;;/h1H,2H2,3H3;1H3;/q-2;-1;+3 |
| InChIKey | CFXIJXQSUPJLCJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.06 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;cobalt(3+);2-methanidylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;cobalt(3+);2-methanidylprop-1-ene?
The IUPAC name of carbanide;cobalt(3+);2-methanidylprop-1-ene (CID 59163874) is carbanide;cobalt(3+);2-methanidylprop-1-ene.
What is the SMILES notation for carbanide;cobalt(3+);2-methanidylprop-1-ene?
The canonical SMILES for carbanide;cobalt(3+);2-methanidylprop-1-ene is [CH3-].[Co+3].[H]/[C-]=C(/[CH2-])C.
What is the InChIKey of carbanide;cobalt(3+);2-methanidylprop-1-ene?
The InChIKey is CFXIJXQSUPJLCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6.CH3.Co/c1-4(2)3;;/h1H,2H2,3H3;1H3;/q-2;-1;+3.
What are the key properties of carbanide;cobalt(3+);2-methanidylprop-1-ene?
carbanide;cobalt(3+);2-methanidylprop-1-ene has a molecular weight of 128.06 g/mol, XLogP of 1.65, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;cobalt(3+);2-methanidylprop-1-ene is sourced from PubChem (CID 59163874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).