C7H11N2O2W-3 — CID 140525116
2,4-dimethylpenta-1,3-diene;nitroxyl anion;tungsten (PubChem CID 140525116) has the molecular formula C7H11N2O2W-3 and a molecular weight of 339.02 g/mol. Its IUPAC name is 2,4-dimethylpenta-1,3-diene;nitroxyl anion;tungsten.
| Compound Name | 2,4-dimethylpenta-1,3-diene;nitroxyl anion;tungsten |
|---|---|
| PubChem CID | 140525116 |
| Molecular Formula | C7H11N2O2W-3 |
| Molecular Weight | 339.02 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2,4-dimethylpenta-1,3-diene;nitroxyl anion;tungsten |
| SMILES | [H]/[C-]=C(/C)C=C(C)C.[N-]=O.[N-]=O.[W] |
| InChI | InChI=1S/C7H11.2NO.W/c1-6(2)5-7(3)4;2*1-2;/h1,5H,2-4H3;;;/q3*-1; |
| InChIKey | BQCPUKIALBRUKX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.02 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|