C17H26Cr — CID 131717665
chromium(2+);2,4-dimethylpenta-1,3-diene;1,2,3,4,5-pentamethylcyclopenta-1,3-diene (PubChem CID 131717665) has the molecular formula C17H26Cr and a molecular weight of 282.39 g/mol. Its IUPAC name is chromium(2+);2,4-dimethylpenta-1,3-diene;1,2,3,4,5-pentamethylcyclopenta-1,3-diene.
| Compound Name | chromium(2+);2,4-dimethylpenta-1,3-diene;1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 131717665 |
| Molecular Formula | C17H26Cr |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | chromium(2+);2,4-dimethylpenta-1,3-diene;1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.[Cr+2].[H]/[C-]=C(/C)C=C(C)C |
| InChI | InChI=1S/C10H15.C7H11.Cr/c1-6-7(2)9(4)10(5)8(6)3;1-6(2)5-7(3)4;/h1-5H3;1,5H,2-4H3;/q2*-1;+2 |
| InChIKey | LOEQCQFIDSALLO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|