About 3-methylbut-2-enoyl iodide
3-methylbut-2-enoyl iodide (PubChem CID 12715993) has the molecular formula C5H7IO
and a molecular weight of 210.01 g/mol. Its IUPAC name is 3-methylbut-2-enoyl iodide.
Molecular Properties
| Compound Name | 3-methylbut-2-enoyl iodide |
| PubChem CID | 12715993 |
| Molecular Formula | C5H7IO |
| Molecular Weight | 210.01 g/mol |
| Exact Mass | 209.95 |
| IUPAC Name | 3-methylbut-2-enoyl iodide |
| SMILES | CC(C)=CC(=O)I |
| InChI | InChI=1S/C5H7IO/c1-4(2)3-5(6)7/h3H,1-2H3 |
| InChIKey | AIONBQYQUMAYGY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.01 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-2-enoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-2-enoyl iodide?
The IUPAC name of 3-methylbut-2-enoyl iodide (CID 12715993) is 3-methylbut-2-enoyl iodide.
What is the SMILES notation for 3-methylbut-2-enoyl iodide?
The canonical SMILES for 3-methylbut-2-enoyl iodide is CC(C)=CC(=O)I.
What is the InChIKey of 3-methylbut-2-enoyl iodide?
The InChIKey is AIONBQYQUMAYGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7IO/c1-4(2)3-5(6)7/h3H,1-2H3.
What are the key properties of 3-methylbut-2-enoyl iodide?
3-methylbut-2-enoyl iodide has a molecular weight of 210.01 g/mol, XLogP of 1.91, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-enoyl iodide is sourced from PubChem (CID 12715993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).