C10H14Ni — CID 173162838
bis(2-methylbuta-1,3-diene);nickel(2+) (PubChem CID 173162838) has the molecular formula C10H14Ni and a molecular weight of 192.91 g/mol. Its IUPAC name is bis(2-methylbuta-1,3-diene);nickel(2+).
| Compound Name | bis(2-methylbuta-1,3-diene);nickel(2+) |
|---|---|
| PubChem CID | 173162838 |
| Molecular Formula | C10H14Ni |
| Molecular Weight | 192.91 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | bis(2-methylbuta-1,3-diene);nickel(2+) |
| SMILES | [H]/[C-]=C(/C)C=C.[H]/[C-]=C(/C)C=C.[Ni+2] |
| InChI | InChI=1S/2C5H7.Ni/c2*1-4-5(2)3;/h2*2,4H,1H2,3H3;/q2*-1;+2 |
| InChIKey | ZGCBHQOLDUNKMM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.91 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|