About [3-[(3E)-5-methylhexa-1,3,5-trien-3-yl]phenyl]-phenylmethanone
[3-[(3E)-5-methylhexa-1,3,5-trien-3-yl]phenyl]-phenylmethanone (PubChem CID 167178533) has the molecular formula C20H18O
and a molecular weight of 274.36 g/mol. Its IUPAC name is [3-[(3E)-5-methylhexa-1,3,5-trien-3-yl]phenyl]-phenylmethanone.
Molecular Properties
| Compound Name | [3-[(3E)-5-methylhexa-1,3,5-trien-3-yl]phenyl]-phenylmethanone |
| PubChem CID | 167178533 |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | [3-[(3E)-5-methylhexa-1,3,5-trien-3-yl]phenyl]-phenylmethanone |
| SMILES | C=C/C(=C\C(=C)C)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H18O/c1-4-16(13-15(2)3)18-11-8-12-19(14-18)20(21)17-9-6-5-7-10-17/h4-14H,1-2H2,3H3/b16-13+ |
| InChIKey | NIPFTSQCVXYCIH-DTQAZKPQSA-N |
| XLogP | 5.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [3-[(3E)-5-methylhexa-1,3,5-trien-3-yl]phenyl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3E)-5-methylhexa-1,3,5-trien-3-yl]phenyl]-phenylmethanone?
The IUPAC name of [3-[(3E)-5-methylhexa-1,3,5-trien-3-yl]phenyl]-phenylmethanone (CID 167178533) is [3-[(3E)-5-methylhexa-1,3,5-trien-3-yl]phenyl]-phenylmethanone.
What is the SMILES notation for [3-[(3E)-5-methylhexa-1,3,5-trien-3-yl]phenyl]-phenylmethanone?
The canonical SMILES for [3-[(3E)-5-methylhexa-1,3,5-trien-3-yl]phenyl]-phenylmethanone is C=C/C(=C\C(=C)C)c1cccc(C(=O)c2ccccc2)c1.
What is the InChIKey of [3-[(3E)-5-methylhexa-1,3,5-trien-3-yl]phenyl]-phenylmethanone?
The InChIKey is NIPFTSQCVXYCIH-DTQAZKPQSA-N. The full InChI is InChI=1S/C20H18O/c1-4-16(13-15(2)3)18-11-8-12-19(14-18)20(21)17-9-6-5-7-10-17/h4-14H,1-2H2,3H3/b16-13+.
What are the key properties of [3-[(3E)-5-methylhexa-1,3,5-trien-3-yl]phenyl]-phenylmethanone?
[3-[(3E)-5-methylhexa-1,3,5-trien-3-yl]phenyl]-phenylmethanone has a molecular weight of 274.36 g/mol, XLogP of 5.06, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3E)-5-methylhexa-1,3,5-trien-3-yl]phenyl]-phenylmethanone is sourced from PubChem (CID 167178533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).