C15H19N — CID 145086695
(1E)-N,N-dimethyl-2-(3-prop-1-en-2-ylphenyl)buta-1,3-dien-1-amine (PubChem CID 145086695) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is (1E)-N,N-dimethyl-2-(3-prop-1-en-2-ylphenyl)buta-1,3-dien-1-amine.
| Compound Name | (1E)-N,N-dimethyl-2-(3-prop-1-en-2-ylphenyl)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 145086695 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (1E)-N,N-dimethyl-2-(3-prop-1-en-2-ylphenyl)buta-1,3-dien-1-amine |
| SMILES | C=C/C(=C\N(C)C)c1cccc(C(=C)C)c1 |
| InChI | InChI=1S/C15H19N/c1-6-13(11-16(4)5)15-9-7-8-14(10-15)12(2)3/h6-11H,1-2H2,3-5H3/b13-11+ |
| InChIKey | OMHWQXGZTAKGDT-ACCUITESSA-N |
| XLogP | 3.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|