C24H29N3 — CID 145086661
(1E)-2-[3-[3,6-dimethyl-5-[(Z)-1-methyliminobut-2-en-2-yl]-2-pyridinyl]phenyl]-N,N-dimethylbuta-1,3-dien-1-amine (PubChem CID 145086661) has the molecular formula C24H29N3 and a molecular weight of 359.52 g/mol. Its IUPAC name is (1E)-2-[3-[3,6-dimethyl-5-[(Z)-1-methyliminobut-2-en-2-yl]-2-pyridinyl]phenyl]-N,N-dimethylbuta-1,3-dien-1-amine.
| Compound Name | (1E)-2-[3-[3,6-dimethyl-5-[(Z)-1-methyliminobut-2-en-2-yl]-2-pyridinyl]phenyl]-N,N-dimethylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 145086661 |
| Molecular Formula | C24H29N3 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | (1E)-2-[3-[3,6-dimethyl-5-[(Z)-1-methyliminobut-2-en-2-yl]-2-pyridinyl]phenyl]-N,N-dimethylbuta-1,3-dien-1-amine |
| SMILES | C=C/C(=C\N(C)C)c1cccc(-c2nc(C)c(C(=C/C)/C=N/C)cc2C)c1 |
| InChI | InChI=1S/C24H29N3/c1-8-19(15-25-5)23-13-17(3)24(26-18(23)4)22-12-10-11-21(14-22)20(9-2)16-27(6)7/h8-16H,2H2,1,3-7H3/b19-8+,20-16+,25-15+ |
| InChIKey | CXGZWTOJNKGZCX-LPKVIQCUSA-N |
| XLogP | 5.56 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|