C31H46N4 — CID 145086619
6-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-3-[(Z)-1-methyliminobut-2-en-2-yl]pyridin-2-amine;ethane;methylcyclohexane (PubChem CID 145086619) has the molecular formula C31H46N4 and a molecular weight of 474.74 g/mol. Its IUPAC name is 6-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-3-[(Z)-1-methyliminobut-2-en-2-yl]pyridin-2-amine;ethane;methylcyclohexane.
| Compound Name | 6-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-3-[(Z)-1-methyliminobut-2-en-2-yl]pyridin-2-amine;ethane;methylcyclohexane |
|---|---|
| PubChem CID | 145086619 |
| Molecular Formula | C31H46N4 |
| Molecular Weight | 474.74 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | 6-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-3-[(Z)-1-methyliminobut-2-en-2-yl]pyridin-2-amine;ethane;methylcyclohexane |
| SMILES | C=C/C(=C\N(C)C)c1cccc(-c2ccc(C(=C/C)/C=N/C)c(N)n2)c1.CC.CC1CCCCC1 |
| InChI | InChI=1S/C22H26N4.C7H14.C2H6/c1-6-16(14-24-3)20-11-12-21(25-22(20)23)19-10-8-9-18(13-19)17(7-2)15-26(4)5;1-7-5-3-2-4-6-7;1-2/h6-15H,2H2,1,3-5H3,(H2,23,25);7H,2-6H2,1H3;1-2H3/b16-6+,17-15+,24-14+;; |
| InChIKey | MOMJIGXHLGWMHW-OZYHKOLNSA-N |
| XLogP | 8.14 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.74 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|