C28H32F7N3 — CID 145086906
(1E)-2-[3-[6-(3,3,4,4,5,5,5-heptafluoropentyl)-5-[(Z)-1-methyliminopent-2-en-2-yl]-2-pyridinyl]phenyl]-N,N-dimethylbuta-1,3-dien-1-amine;molecular hydrogen (PubChem CID 145086906) has the molecular formula C28H32F7N3 and a molecular weight of 543.57 g/mol. Its IUPAC name is (1E)-2-[3-[6-(3,3,4,4,5,5,5-heptafluoropentyl)-5-[(Z)-1-methyliminopent-2-en-2-yl]-2-pyridinyl]phenyl]-N,N-dimethylbuta-1,3-dien-1-amine;molecular hydrogen.
| Compound Name | (1E)-2-[3-[6-(3,3,4,4,5,5,5-heptafluoropentyl)-5-[(Z)-1-methyliminopent-2-en-2-yl]-2-pyridinyl]phenyl]-N,N-dimethylbuta-1,3-dien-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 145086906 |
| Molecular Formula | C28H32F7N3 |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | (1E)-2-[3-[6-(3,3,4,4,5,5,5-heptafluoropentyl)-5-[(Z)-1-methyliminopent-2-en-2-yl]-2-pyridinyl]phenyl]-N,N-dimethylbuta-1,3-dien-1-amine;molecular hydrogen |
| SMILES | C=C/C(=C\N(C)C)c1cccc(-c2ccc(C(=C/CC)/C=N/C)c(CCC(F)(F)C(F)(F)C(F)(F)F)n2)c1.[H][H] |
| InChI | InChI=1S/C28H30F7N3.H2/c1-6-9-22(17-36-3)23-12-13-24(21-11-8-10-20(16-21)19(7-2)18-38(4)5)37-25(23)14-15-26(29,30)27(31,32)28(33,34)35;/h7-13,16-18H,2,6,14-15H2,1,3-5H3;1H/b19-18+,22-9+,36-17+; |
| InChIKey | BVMWTUOFDUBFQE-LZZYXSKKSA-N |
| XLogP | 8.34 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|