C22H28N4 — CID 145086945
6-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-3-[(Z)-1-methyliminobut-2-en-2-yl]-1,2-dihydropyridin-2-amine (PubChem CID 145086945) has the molecular formula C22H28N4 and a molecular weight of 348.49 g/mol. Its IUPAC name is 6-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-3-[(Z)-1-methyliminobut-2-en-2-yl]-1,2-dihydropyridin-2-amine.
| Compound Name | 6-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-3-[(Z)-1-methyliminobut-2-en-2-yl]-1,2-dihydropyridin-2-amine |
|---|---|
| PubChem CID | 145086945 |
| Molecular Formula | C22H28N4 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 6-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-3-[(Z)-1-methyliminobut-2-en-2-yl]-1,2-dihydropyridin-2-amine |
| SMILES | C=C/C(=C\N(C)C)c1cccc(C2=CC=C(C(=C/C)/C=N/C)C(N)N2)c1 |
| InChI | InChI=1S/C22H28N4/c1-6-16(14-24-3)20-11-12-21(25-22(20)23)19-10-8-9-18(13-19)17(7-2)15-26(4)5/h6-15,22,25H,2,23H2,1,3-5H3/b16-6+,17-15+,24-14+ |
| InChIKey | RUQSVPJQVCDZOB-WHRHUIEASA-N |
| XLogP | 3.58 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|