C28H36N4 — CID 145087056
N-cyclopentyl-6-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-5-methyl-3-[(Z)-1-methyliminobut-2-en-2-yl]pyridin-2-amine (PubChem CID 145087056) has the molecular formula C28H36N4 and a molecular weight of 428.62 g/mol. Its IUPAC name is N-cyclopentyl-6-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-5-methyl-3-[(Z)-1-methyliminobut-2-en-2-yl]pyridin-2-amine.
| Compound Name | N-cyclopentyl-6-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-5-methyl-3-[(Z)-1-methyliminobut-2-en-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 145087056 |
| Molecular Formula | C28H36N4 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | N-cyclopentyl-6-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-5-methyl-3-[(Z)-1-methyliminobut-2-en-2-yl]pyridin-2-amine |
| SMILES | C=C/C(=C\N(C)C)c1cccc(-c2nc(NC3CCCC3)c(C(=C/C)/C=N/C)cc2C)c1 |
| InChI | InChI=1S/C28H36N4/c1-7-21(18-29-4)26-16-20(3)27(31-28(26)30-25-14-9-10-15-25)24-13-11-12-23(17-24)22(8-2)19-32(5)6/h7-8,11-13,16-19,25H,2,9-10,14-15H2,1,3-6H3,(H,30,31)/b21-7+,22-19+,29-18+ |
| InChIKey | PBWAOQYWLIWALY-VKNRHYNYSA-N |
| XLogP | 6.60 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|