C24H32N6O2S — CID 145086933
2-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-N-(1,1-dioxothian-4-yl)-5-[(E)-C-methyl-N-(methylamino)carbonimidoyl]pyrimidin-4-amine (PubChem CID 145086933) has the molecular formula C24H32N6O2S and a molecular weight of 468.63 g/mol. Its IUPAC name is 2-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-N-(1,1-dioxothian-4-yl)-5-[(E)-C-methyl-N-(methylamino)carbonimidoyl]pyrimidin-4-amine.
| Compound Name | 2-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-N-(1,1-dioxothian-4-yl)-5-[(E)-C-methyl-N-(methylamino)carbonimidoyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 145086933 |
| Molecular Formula | C24H32N6O2S |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 2-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-N-(1,1-dioxothian-4-yl)-5-[(E)-C-methyl-N-(methylamino)carbonimidoyl]pyrimidin-4-amine |
| SMILES | C=C/C(=C\N(C)C)c1cccc(-c2ncc(/C(C)=N/NC)c(NC3CCS(=O)(=O)CC3)n2)c1 |
| InChI | InChI=1S/C24H32N6O2S/c1-6-18(16-30(4)5)19-8-7-9-20(14-19)23-26-15-22(17(2)29-25-3)24(28-23)27-21-10-12-33(31,32)13-11-21/h6-9,14-16,21,25H,1,10-13H2,2-5H3,(H,26,27,28)/b18-16+,29-17+ |
| InChIKey | SODVPXYVXRNCKM-KADBGPLJSA-N |
| XLogP | 3.16 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|