C11H14Ti — CID 173337087
cyclopenta-1,3-diene;2-methylpenta-1,3-diene;titanium(2+) (PubChem CID 173337087) has the molecular formula C11H14Ti and a molecular weight of 194.10 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-methylpenta-1,3-diene;titanium(2+).
| Compound Name | cyclopenta-1,3-diene;2-methylpenta-1,3-diene;titanium(2+) |
|---|---|
| PubChem CID | 173337087 |
| Molecular Formula | C11H14Ti |
| Molecular Weight | 194.10 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | cyclopenta-1,3-diene;2-methylpenta-1,3-diene;titanium(2+) |
| SMILES | [C-]1=CC=CC1.[H]/[C-]=C(/C)C=CC.[Ti+2] |
| InChI | InChI=1S/C6H9.C5H5.Ti/c1-4-5-6(2)3;1-2-4-5-3-1;/h2,4-5H,1,3H3;1-3H,4H2;/q2*-1;+2 |
| InChIKey | GOOBQOTVCYEMGG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.10 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|