C16H20Zr — CID 22261293
bis(cyclopenta-1,3-diene);2,3-dimethylbuta-1,3-diene;zirconium(2+) (PubChem CID 22261293) has the molecular formula C16H20Zr and a molecular weight of 303.56 g/mol. Its IUPAC name is bis(cyclopenta-1,3-diene);2,3-dimethylbuta-1,3-diene;zirconium(2+).
| Compound Name | bis(cyclopenta-1,3-diene);2,3-dimethylbuta-1,3-diene;zirconium(2+) |
|---|---|
| PubChem CID | 22261293 |
| Molecular Formula | C16H20Zr |
| Molecular Weight | 303.56 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | bis(cyclopenta-1,3-diene);2,3-dimethylbuta-1,3-diene;zirconium(2+) |
| SMILES | C=C(C)C(=C)C.[C-]1=CC=CC1.[C-]1=CC=CC1.[Zr+2] |
| InChI | InChI=1S/C6H10.2C5H5.Zr/c1-5(2)6(3)4;2*1-2-4-5-3-1;/h1,3H2,2,4H3;2*1-3H,4H2;/q;2*-1;+2 |
| InChIKey | OPKAUMMVEYBYMU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|