C10H10V — CID 73455747
bis(cyclopenta-1,3-diene);vanadium(2+) (PubChem CID 73455747) has the molecular formula C10H10V and a molecular weight of 181.13 g/mol. Its IUPAC name is bis(cyclopenta-1,3-diene);vanadium(2+).
| Compound Name | bis(cyclopenta-1,3-diene);vanadium(2+) |
|---|---|
| PubChem CID | 73455747 |
| Molecular Formula | C10H10V |
| Molecular Weight | 181.13 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | bis(cyclopenta-1,3-diene);vanadium(2+) |
| SMILES | [C-]1=CC=CC1.[C-]1=CC=CC1.[V+2] |
| InChI | InChI=1S/2C5H5.V/c2*1-2-4-5-3-1;/h2*1-3H,4H2;/q2*-1;+2 |
| InChIKey | KTKDULBCFYEWFV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.13 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|