C6H8Os — CID 140608310
carbanide;cyclopenta-1,3-diene;osmium(2+) (PubChem CID 140608310) has the molecular formula C6H8Os and a molecular weight of 270.36 g/mol. Its IUPAC name is carbanide;cyclopenta-1,3-diene;osmium(2+).
| Compound Name | carbanide;cyclopenta-1,3-diene;osmium(2+) |
|---|---|
| PubChem CID | 140608310 |
| Molecular Formula | C6H8Os |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | carbanide;cyclopenta-1,3-diene;osmium(2+) |
| SMILES | [C-]1=CC=CC1.[CH3-].[Os+2] |
| InChI | InChI=1S/C5H5.CH3.Os/c1-2-4-5-3-1;;/h1-3H,4H2;1H3;/q2*-1;+2 |
| InChIKey | NTWKHVLARIHIPL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|