About zinc;carbanide;cyclopenta-1,3-diene
zinc;carbanide;cyclopenta-1,3-diene (PubChem CID 23116545) has the molecular formula C6H8Zn
and a molecular weight of 145.52 g/mol. Its IUPAC name is zinc;carbanide;cyclopenta-1,3-diene.
Molecular Properties
| Compound Name | zinc;carbanide;cyclopenta-1,3-diene |
| PubChem CID | 23116545 |
| Molecular Formula | C6H8Zn |
| Molecular Weight | 145.52 g/mol |
| Exact Mass | 143.99 |
| IUPAC Name | zinc;carbanide;cyclopenta-1,3-diene |
| SMILES | [C-]1=CC=CC1.[CH3-].[Zn+2] |
| InChI | InChI=1S/C5H5.CH3.Zn/c1-2-4-5-3-1;;/h1-3H,4H2;1H3;/q2*-1;+2 |
| InChIKey | QIUVZISRGFJEFP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.52 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;carbanide;cyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;carbanide;cyclopenta-1,3-diene?
The IUPAC name of zinc;carbanide;cyclopenta-1,3-diene (CID 23116545) is zinc;carbanide;cyclopenta-1,3-diene.
What is the SMILES notation for zinc;carbanide;cyclopenta-1,3-diene?
The canonical SMILES for zinc;carbanide;cyclopenta-1,3-diene is [C-]1=CC=CC1.[CH3-].[Zn+2].
What is the InChIKey of zinc;carbanide;cyclopenta-1,3-diene?
The InChIKey is QIUVZISRGFJEFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5.CH3.Zn/c1-2-4-5-3-1;;/h1-3H,4H2;1H3;/q2*-1;+2.
What are the key properties of zinc;carbanide;cyclopenta-1,3-diene?
zinc;carbanide;cyclopenta-1,3-diene has a molecular weight of 145.52 g/mol, XLogP of 1.75, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;carbanide;cyclopenta-1,3-diene is sourced from PubChem (CID 23116545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).