C6H8Zn — CID 23116545
zinc;carbanide;cyclopenta-1,3-diene (PubChem CID 23116545) has the molecular formula C6H8Zn and a molecular weight of 145.52 g/mol. Its IUPAC name is zinc;carbanide;cyclopenta-1,3-diene.
| Compound Name | zinc;carbanide;cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 23116545 |
| Molecular Formula | C6H8Zn |
| Molecular Weight | 145.52 g/mol |
| Exact Mass | 143.99 |
| IUPAC Name | zinc;carbanide;cyclopenta-1,3-diene |
| SMILES | [C-]1=CC=CC1.[CH3-].[Zn+2] |
| InChI | InChI=1S/C5H5.CH3.Zn/c1-2-4-5-3-1;;/h1-3H,4H2;1H3;/q2*-1;+2 |
| InChIKey | QIUVZISRGFJEFP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.52 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|