C10H10Sr — CID 14513562
strontium bis(cyclopenta-1,3-diene) (PubChem CID 14513562) has the molecular formula C10H10Sr and a molecular weight of 217.81 g/mol. Its IUPAC name is strontium bis(cyclopenta-1,3-diene).
| Compound Name | strontium bis(cyclopenta-1,3-diene) |
|---|---|
| PubChem CID | 14513562 |
| Molecular Formula | C10H10Sr |
| Molecular Weight | 217.81 g/mol |
| Exact Mass | 217.98 |
| IUPAC Name | strontium bis(cyclopenta-1,3-diene) |
| SMILES | [C-]1=CC=CC1.[C-]1=CC=CC1.[Sr+2] |
| InChI | InChI=1S/2C5H5.Sr/c2*1-2-4-5-3-1;/h2*1-3H,4H2;/q2*-1;+2 |
| InChIKey | MIFPWALZNIINBN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.81 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|