C12H14Ti — CID 150696595
cyclohepta-1,3,5-triene;penta-1,3-diene;titanium(2+) (PubChem CID 150696595) has the molecular formula C12H14Ti and a molecular weight of 206.11 g/mol. Its IUPAC name is cyclohepta-1,3,5-triene;penta-1,3-diene;titanium(2+).
| Compound Name | cyclohepta-1,3,5-triene;penta-1,3-diene;titanium(2+) |
|---|---|
| PubChem CID | 150696595 |
| Molecular Formula | C12H14Ti |
| Molecular Weight | 206.11 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | cyclohepta-1,3,5-triene;penta-1,3-diene;titanium(2+) |
| SMILES | [C-]1=CC=CC=CC1.[H]/[C-]=C\C=CC.[Ti+2] |
| InChI | InChI=1S/C7H7.C5H7.Ti/c1-2-4-6-7-5-3-1;1-3-5-4-2;/h1-5H,6H2;1,3-5H,2H3;/q2*-1;+2 |
| InChIKey | JKZABMPCRRBGHB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.11 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|