C13H18Co — CID 151800082
cobalt(2+);cycloocta-1,3-diene;penta-1,3-diene (PubChem CID 151800082) has the molecular formula C13H18Co and a molecular weight of 233.22 g/mol. Its IUPAC name is cobalt(2+);cycloocta-1,3-diene;penta-1,3-diene.
| Compound Name | cobalt(2+);cycloocta-1,3-diene;penta-1,3-diene |
|---|---|
| PubChem CID | 151800082 |
| Molecular Formula | C13H18Co |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | cobalt(2+);cycloocta-1,3-diene;penta-1,3-diene |
| SMILES | [C-]1=C\C=CCCCC/1.[Co+2].[H]/[C-]=C\C=CC |
| InChI | InChI=1S/C8H11.C5H7.Co/c1-2-4-6-8-7-5-3-1;1-3-5-4-2;/h1-3H,4,6-8H2;1,3-5H,2H3;/q2*-1;+2 |
| InChIKey | RYKRZAZIMFQZMW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|