About cobalt(2+);cycloocta-1,3-diene;penta-1,3-diene
cobalt(2+);cycloocta-1,3-diene;penta-1,3-diene (PubChem CID 151800082) has the molecular formula C13H18Co
and a molecular weight of 233.22 g/mol. Its IUPAC name is cobalt(2+);cycloocta-1,3-diene;penta-1,3-diene.
Molecular Properties
| Compound Name | cobalt(2+);cycloocta-1,3-diene;penta-1,3-diene |
| PubChem CID | 151800082 |
| Molecular Formula | C13H18Co |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | cobalt(2+);cycloocta-1,3-diene;penta-1,3-diene |
| SMILES | [C-]1=C\C=CCCCC/1.[Co+2].[H]/[C-]=C\C=CC |
| InChI | InChI=1S/C8H11.C5H7.Co/c1-2-4-6-8-7-5-3-1;1-3-5-4-2;/h1-3H,4,6-8H2;1,3-5H,2H3;/q2*-1;+2 |
| InChIKey | RYKRZAZIMFQZMW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze cobalt(2+);cycloocta-1,3-diene;penta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);cycloocta-1,3-diene;penta-1,3-diene?
The IUPAC name of cobalt(2+);cycloocta-1,3-diene;penta-1,3-diene (CID 151800082) is cobalt(2+);cycloocta-1,3-diene;penta-1,3-diene.
What is the SMILES notation for cobalt(2+);cycloocta-1,3-diene;penta-1,3-diene?
The canonical SMILES for cobalt(2+);cycloocta-1,3-diene;penta-1,3-diene is [C-]1=C\C=CCCCC/1.[Co+2].[H]/[C-]=C\C=CC.
What is the InChIKey of cobalt(2+);cycloocta-1,3-diene;penta-1,3-diene?
The InChIKey is RYKRZAZIMFQZMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11.C5H7.Co/c1-2-4-6-8-7-5-3-1;1-3-5-4-2;/h1-3H,4,6-8H2;1,3-5H,2H3;/q2*-1;+2.
What are the key properties of cobalt(2+);cycloocta-1,3-diene;penta-1,3-diene?
cobalt(2+);cycloocta-1,3-diene;penta-1,3-diene has a molecular weight of 233.22 g/mol, XLogP of 4.03, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);cycloocta-1,3-diene;penta-1,3-diene is sourced from PubChem (CID 151800082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).