About carbanide;(Z)-N-[(Z)-propan-2-ylideneamino]propan-2-imine;decakis(yttrium)
carbanide;(Z)-N-[(Z)-propan-2-ylideneamino]propan-2-imine;decakis(yttrium) (PubChem CID 58298914) has the molecular formula C10H22N2Y10-6
and a molecular weight of 1059.36 g/mol. Its IUPAC name is carbanide;(Z)-N-[(Z)-propan-2-ylideneamino]propan-2-imine;decakis(yttrium).
Molecular Properties
| Compound Name | carbanide;(Z)-N-[(Z)-propan-2-ylideneamino]propan-2-imine;decakis(yttrium) |
| PubChem CID | 58298914 |
| Molecular Formula | C10H22N2Y10-6 |
| Molecular Weight | 1059.36 g/mol |
| Exact Mass | 1059.24 |
| IUPAC Name | carbanide;(Z)-N-[(Z)-propan-2-ylideneamino]propan-2-imine;decakis(yttrium) |
| SMILES | [CH2-]/C(C)=N/N=C(/[CH2-])C.[CH3-].[CH3-].[CH3-].[CH3-].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C6H10N2.4CH3.10Y/c1-5(2)7-8-6(3)4;;;;;;;;;;;;;;/h1,3H2,2,4H3;4*1H3;;;;;;;;;;/q-2;4*-1;;;;;;;;;;/b7-5-,8-6-;;;;;;;;;;;;;; |
| InChIKey | MDDLUFMDPYDYMI-NRGNASRWSA-N |
| XLogP | 3.27 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 1059.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze carbanide;(Z)-N-[(Z)-propan-2-ylideneamino]propan-2-imine;decakis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;(Z)-N-[(Z)-propan-2-ylideneamino]propan-2-imine;decakis(yttrium)?
The IUPAC name of carbanide;(Z)-N-[(Z)-propan-2-ylideneamino]propan-2-imine;decakis(yttrium) (CID 58298914) is carbanide;(Z)-N-[(Z)-propan-2-ylideneamino]propan-2-imine;decakis(yttrium).
What is the SMILES notation for carbanide;(Z)-N-[(Z)-propan-2-ylideneamino]propan-2-imine;decakis(yttrium)?
The canonical SMILES for carbanide;(Z)-N-[(Z)-propan-2-ylideneamino]propan-2-imine;decakis(yttrium) is [CH2-]/C(C)=N/N=C(/[CH2-])C.[CH3-].[CH3-].[CH3-].[CH3-].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].
What is the InChIKey of carbanide;(Z)-N-[(Z)-propan-2-ylideneamino]propan-2-imine;decakis(yttrium)?
The InChIKey is MDDLUFMDPYDYMI-NRGNASRWSA-N. The full InChI is InChI=1S/C6H10N2.4CH3.10Y/c1-5(2)7-8-6(3)4;;;;;;;;;;;;;;/h1,3H2,2,4H3;4*1H3;;;;;;;;;;/q-2;4*-1;;;;;;;;;;/b7-5-,8-6-;;;;;;;;;;;;;;.
What are the key properties of carbanide;(Z)-N-[(Z)-propan-2-ylideneamino]propan-2-imine;decakis(yttrium)?
carbanide;(Z)-N-[(Z)-propan-2-ylideneamino]propan-2-imine;decakis(yttrium) has a molecular weight of 1059.36 g/mol, XLogP of 3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;(Z)-N-[(Z)-propan-2-ylideneamino]propan-2-imine;decakis(yttrium) is sourced from PubChem (CID 58298914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).