C14H18Ru — CID 170920823
bis(4-methanidyl-2-methylpenta-1,3-diene);ruthenium(6+) (PubChem CID 170920823) has the molecular formula C14H18Ru and a molecular weight of 287.37 g/mol. Its IUPAC name is bis(4-methanidyl-2-methylpenta-1,3-diene);ruthenium(6+).
| Compound Name | bis(4-methanidyl-2-methylpenta-1,3-diene);ruthenium(6+) |
|---|---|
| PubChem CID | 170920823 |
| Molecular Formula | C14H18Ru |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | bis(4-methanidyl-2-methylpenta-1,3-diene);ruthenium(6+) |
| SMILES | [H]/[C-]=C(C)/[C-]=C(\[CH2-])C.[H]/[C-]=C(\C)[C-]=C([CH2-])C.[Ru+6] |
| InChI | InChI=1S/2C7H9.Ru/c2*1-6(2)5-7(3)4;/h2*1H,3H2,2,4H3;/q2*-3;+6 |
| InChIKey | YGFLYAVWQWHHGI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|