C12H20Y-2 — CID 149329488
3,4-dimethanidylidene-2,2,5,5-tetramethylhexane;yttrium (PubChem CID 149329488) has the molecular formula C12H20Y-2 and a molecular weight of 253.20 g/mol. Its IUPAC name is 3,4-dimethanidylidene-2,2,5,5-tetramethylhexane;yttrium.
| Compound Name | 3,4-dimethanidylidene-2,2,5,5-tetramethylhexane;yttrium |
|---|---|
| PubChem CID | 149329488 |
| Molecular Formula | C12H20Y-2 |
| Molecular Weight | 253.20 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 3,4-dimethanidylidene-2,2,5,5-tetramethylhexane;yttrium |
| SMILES | [H]/[C-]=C(C(=[C-]/[H])/C(C)(C)C)\C(C)(C)C.[Y] |
| InChI | InChI=1S/C12H20.Y/c1-9(11(3,4)5)10(2)12(6,7)8;/h1-2H,3-8H3;/q-2; |
| InChIKey | FXGIOHWLHLKKQH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.20 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|