C5H10N2Rb2 — CID 143087197
(1-azanidyl-2,2-dimethylpropylidene)azanide;bis(rubidium(1+)) (PubChem CID 143087197) has the molecular formula C5H10N2Rb2 and a molecular weight of 269.09 g/mol. Its IUPAC name is (1-azanidyl-2,2-dimethylpropylidene)azanide;bis(rubidium(1+)).
| Compound Name | (1-azanidyl-2,2-dimethylpropylidene)azanide;bis(rubidium(1+)) |
|---|---|
| PubChem CID | 143087197 |
| Molecular Formula | C5H10N2Rb2 |
| Molecular Weight | 269.09 g/mol |
| Exact Mass | 267.91 |
| IUPAC Name | (1-azanidyl-2,2-dimethylpropylidene)azanide;bis(rubidium(1+)) |
| SMILES | CC(C)(C)C(=[N-])[NH-].[Rb+].[Rb+] |
| InChI | InChI=1S/C5H10N2.2Rb/c1-5(2,3)4(6)7;;/h1-3H3,(H-2,6,7);;/q-2;2*+1 |
| InChIKey | ASORYRZBUDBZIP-UHFFFAOYSA-N |
| XLogP | -3.94 |
| TPSA | 46.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.09 |
| LogP ≤ 5 | -3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|