C9H18N2 — CID 638177
3-diazo-2,2,4,4-tetramethylpentane (PubChem CID 638177) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 3-diazo-2,2,4,4-tetramethylpentane.
| Compound Name | 3-diazo-2,2,4,4-tetramethylpentane |
|---|---|
| PubChem CID | 638177 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 3-diazo-2,2,4,4-tetramethylpentane |
| SMILES | CC(C)(C)C(=[N+]=[N-])C(C)(C)C |
| InChI | InChI=1S/C9H18N2/c1-8(2,3)7(11-10)9(4,5)6/h1-6H3 |
| InChIKey | KEJDZOJSZYVXBU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|