C20H30N2O5S — CID 90703852
1-diazo-1-(3,4-dibutoxyphenyl)sulfonyl-3,3-dimethylbutan-2-one (PubChem CID 90703852) has the molecular formula C20H30N2O5S and a molecular weight of 410.54 g/mol. Its IUPAC name is 1-diazo-1-(3,4-dibutoxyphenyl)sulfonyl-3,3-dimethylbutan-2-one.
| Compound Name | 1-diazo-1-(3,4-dibutoxyphenyl)sulfonyl-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 90703852 |
| Molecular Formula | C20H30N2O5S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 1-diazo-1-(3,4-dibutoxyphenyl)sulfonyl-3,3-dimethylbutan-2-one |
| SMILES | CCCCOc1ccc(S(=O)(=O)C(=[N+]=[N-])C(=O)C(C)(C)C)cc1OCCCC |
| InChI | InChI=1S/C20H30N2O5S/c1-6-8-12-26-16-11-10-15(14-17(16)27-13-9-7-2)28(24,25)19(22-21)18(23)20(3,4)5/h10-11,14H,6-9,12-13H2,1-5H3 |
| InChIKey | ZBVSLOKDWCDDRW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 106.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|