C31H46N2O6S2 — CID 23437445
4-[diazo-(3-methyl-4-octoxyphenyl)sulfonylmethyl]sulfonyl-2-methyl-1-octoxybenzene (PubChem CID 23437445) has the molecular formula C31H46N2O6S2 and a molecular weight of 606.85 g/mol. Its IUPAC name is 4-[diazo-(3-methyl-4-octoxyphenyl)sulfonylmethyl]sulfonyl-2-methyl-1-octoxybenzene.
| Compound Name | 4-[diazo-(3-methyl-4-octoxyphenyl)sulfonylmethyl]sulfonyl-2-methyl-1-octoxybenzene |
|---|---|
| PubChem CID | 23437445 |
| Molecular Formula | C31H46N2O6S2 |
| Molecular Weight | 606.85 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | 4-[diazo-(3-methyl-4-octoxyphenyl)sulfonylmethyl]sulfonyl-2-methyl-1-octoxybenzene |
| SMILES | CCCCCCCCOc1ccc(S(=O)(=O)C(=[N+]=[N-])S(=O)(=O)c2ccc(OCCCCCCCC)c(C)c2)cc1C |
| InChI | InChI=1S/C31H46N2O6S2/c1-5-7-9-11-13-15-21-38-29-19-17-27(23-25(29)3)40(34,35)31(33-32)41(36,37)28-18-20-30(26(4)24-28)39-22-16-14-12-10-8-6-2/h17-20,23-24H,5-16,21-22H2,1-4H3 |
| InChIKey | CXDDJXJXVMDUQW-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 123.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.85 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|