C35H54N2O6S2 — CID 23437442
1-[diazo-(4-heptoxy-2-methyl-5-propan-2-ylphenyl)sulfonylmethyl]sulfonyl-4-heptoxy-2-methyl-5-propan-2-ylbenzene (PubChem CID 23437442) has the molecular formula C35H54N2O6S2 and a molecular weight of 662.96 g/mol. Its IUPAC name is 1-[diazo-(4-heptoxy-2-methyl-5-propan-2-ylphenyl)sulfonylmethyl]sulfonyl-4-heptoxy-2-methyl-5-propan-2-ylbenzene.
| Compound Name | 1-[diazo-(4-heptoxy-2-methyl-5-propan-2-ylphenyl)sulfonylmethyl]sulfonyl-4-heptoxy-2-methyl-5-propan-2-ylbenzene |
|---|---|
| PubChem CID | 23437442 |
| Molecular Formula | C35H54N2O6S2 |
| Molecular Weight | 662.96 g/mol |
| Exact Mass | 662.34 |
| IUPAC Name | 1-[diazo-(4-heptoxy-2-methyl-5-propan-2-ylphenyl)sulfonylmethyl]sulfonyl-4-heptoxy-2-methyl-5-propan-2-ylbenzene |
| SMILES | CCCCCCCOc1cc(C)c(S(=O)(=O)C(=[N+]=[N-])S(=O)(=O)c2cc(C(C)C)c(OCCCCCCC)cc2C)cc1C(C)C |
| InChI | InChI=1S/C35H54N2O6S2/c1-9-11-13-15-17-19-42-31-21-27(7)33(23-29(31)25(3)4)44(38,39)35(37-36)45(40,41)34-24-30(26(5)6)32(22-28(34)8)43-20-18-16-14-12-10-2/h21-26H,9-20H2,1-8H3 |
| InChIKey | JFAPDQLJAIKCEG-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 123.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.96 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|