C18H26N2O4S — CID 74053017
1-diazo-1-(4-hexoxyphenyl)sulfonyl-3,3-dimethylbutan-2-one (PubChem CID 74053017) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is 1-diazo-1-(4-hexoxyphenyl)sulfonyl-3,3-dimethylbutan-2-one.
| Compound Name | 1-diazo-1-(4-hexoxyphenyl)sulfonyl-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 74053017 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1-diazo-1-(4-hexoxyphenyl)sulfonyl-3,3-dimethylbutan-2-one |
| SMILES | CCCCCCOc1ccc(S(=O)(=O)C(=[N+]=[N-])C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H26N2O4S/c1-5-6-7-8-13-24-14-9-11-15(12-10-14)25(22,23)17(20-19)16(21)18(2,3)4/h9-12H,5-8,13H2,1-4H3 |
| InChIKey | AKOUHHDNPJHCDU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|